C24H23F6N3O2 — CID 131981134
5-pyrrolidin-2-yl-3-[3-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)phenyl]butoxy]phenyl]-1,2,4-oxadiazole (PubChem CID 131981134) has the molecular formula C24H23F6N3O2 and a molecular weight of 499.46 g/mol. Its IUPAC name is 5-pyrrolidin-2-yl-3-[3-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)phenyl]butoxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-pyrrolidin-2-yl-3-[3-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)phenyl]butoxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131981134 |
| Molecular Formula | C24H23F6N3O2 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 5-pyrrolidin-2-yl-3-[3-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)phenyl]butoxy]phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(CCCCOc2ccc(-c3noc(C4CCCN4)n3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23F6N3O2/c25-23(26,27)17-9-6-15(7-10-17)4-1-2-13-34-20-11-8-16(14-18(20)24(28,29)30)21-32-22(35-33-21)19-5-3-12-31-19/h6-11,14,19,31H,1-5,12-13H2 |
| InChIKey | FFBBUDZQLOOBAR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|