C21H26F3N3O2 — CID 155353226
3-[4-[(Z)-oct-3-enoxy]-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole (PubChem CID 155353226) has the molecular formula C21H26F3N3O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-[4-[(Z)-oct-3-enoxy]-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-[4-[(Z)-oct-3-enoxy]-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155353226 |
| Molecular Formula | C21H26F3N3O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-[4-[(Z)-oct-3-enoxy]-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
| SMILES | CCCC/C=C\CCOc1ccc(-c2noc(C3CCCN3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H26F3N3O2/c1-2-3-4-5-6-7-13-28-18-11-10-15(14-16(18)21(22,23)24)19-26-20(29-27-19)17-9-8-12-25-17/h5-6,10-11,14,17,25H,2-4,7-9,12-13H2,1H3/b6-5- |
| InChIKey | WSJYZCUGBAFPPR-WAYWQWQTSA-N |
| XLogP | 5.70 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|