C22H30F3N5O4 — CID 171931454
(2S,3S)-N',3-dihydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 171931454) has the molecular formula C22H30F3N5O4 and a molecular weight of 485.51 g/mol. Its IUPAC name is (2S,3S)-N',3-dihydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S,3S)-N',3-dihydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 171931454 |
| Molecular Formula | C22H30F3N5O4 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (2S,3S)-N',3-dihydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | CCCCCCCCOc1ccc(-c2noc([C@@H]3[C@@H](O)CCN3C(N)=NO)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H30F3N5O4/c1-2-3-4-5-6-7-12-33-17-9-8-14(13-15(17)22(23,24)25)19-27-20(34-29-19)18-16(31)10-11-30(18)21(26)28-32/h8-9,13,16,18,31-32H,2-7,10-12H2,1H3,(H2,26,28)/t16-,18-/m0/s1 |
| InChIKey | RAYPBCKADRYHRD-WMZOPIPTSA-N |
| XLogP | 4.31 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|