C25H39F3N4O2 — CID 145056686
ethanimidamide;5-[(2S)-hexan-2-yl]-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 145056686) has the molecular formula C25H39F3N4O2 and a molecular weight of 484.61 g/mol. Its IUPAC name is ethanimidamide;5-[(2S)-hexan-2-yl]-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | ethanimidamide;5-[(2S)-hexan-2-yl]-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145056686 |
| Molecular Formula | C25H39F3N4O2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | ethanimidamide;5-[(2S)-hexan-2-yl]-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2noc([C@@H](C)CCCC)n2)cc1C(F)(F)F.[H]/N=C(\C)N |
| InChI | InChI=1S/C23H33F3N2O2.C2H6N2/c1-4-6-8-9-10-11-15-29-20-14-13-18(16-19(20)23(24,25)26)21-27-22(30-28-21)17(3)12-7-5-2;1-2(3)4/h13-14,16-17H,4-12,15H2,1-3H3;1H3,(H3,3,4)/t17-;/m0./s1 |
| InChIKey | YABAYIBGHLMNTD-LMOVPXPDSA-N |
| XLogP | 7.73 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|