C23H31F5N2O2 — CID 131981391
5-(4,4-difluorohexan-2-yl)-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 131981391) has the molecular formula C23H31F5N2O2 and a molecular weight of 462.50 g/mol. Its IUPAC name is 5-(4,4-difluorohexan-2-yl)-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-(4,4-difluorohexan-2-yl)-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131981391 |
| Molecular Formula | C23H31F5N2O2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 5-(4,4-difluorohexan-2-yl)-3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2noc(C(C)CC(F)(F)CC)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H31F5N2O2/c1-4-6-7-8-9-10-13-31-19-12-11-17(14-18(19)23(26,27)28)20-29-21(32-30-20)16(3)15-22(24,25)5-2/h11-12,14,16H,4-10,13,15H2,1-3H3 |
| InChIKey | VVNSCYFCRUCRRP-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|