C23H30N2O2 — CID 131981288
5-hexan-2-yl-3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazole (PubChem CID 131981288) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-hexan-2-yl-3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-hexan-2-yl-3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131981288 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 5-hexan-2-yl-3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazole |
| SMILES | CCCCCOc1ccc2cc(-c3noc(C(C)CCCC)n3)ccc2c1 |
| InChI | InChI=1S/C23H30N2O2/c1-4-6-8-14-26-21-13-12-18-15-20(11-10-19(18)16-21)22-24-23(27-25-22)17(3)9-7-5-2/h10-13,15-17H,4-9,14H2,1-3H3 |
| InChIKey | AOJIQXHPSNARFH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|