C31H40N4O2 — CID 145056874
5-hexan-2-yl-3-[6-[(4-methylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazole;2-methylbutanimidamide (PubChem CID 145056874) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 5-hexan-2-yl-3-[6-[(4-methylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazole;2-methylbutanimidamide.
| Compound Name | 5-hexan-2-yl-3-[6-[(4-methylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazole;2-methylbutanimidamide |
|---|---|
| PubChem CID | 145056874 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 5-hexan-2-yl-3-[6-[(4-methylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazole;2-methylbutanimidamide |
| SMILES | CCCCC(C)c1nc(-c2ccc3cc(OCc4ccc(C)cc4)ccc3c2)no1.[H]/N=C(\N)C(C)CC |
| InChI | InChI=1S/C26H28N2O2.C5H12N2/c1-4-5-6-19(3)26-27-25(28-30-26)23-12-11-22-16-24(14-13-21(22)15-23)29-17-20-9-7-18(2)8-10-20;1-3-4(2)5(6)7/h7-16,19H,4-6,17H2,1-3H3;4H,3H2,1-2H3,(H3,6,7) |
| InChIKey | DPWWMSLCZRJRAO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|