C21H27N3O2 — CID 145378560
(1S)-1-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]-N-methylbutan-1-amine (PubChem CID 145378560) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (1S)-1-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]-N-methylbutan-1-amine.
| Compound Name | (1S)-1-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 145378560 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (1S)-1-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]-N-methylbutan-1-amine |
| SMILES | CCCCOc1ccc2cc(-c3noc([C@H](CCC)NC)n3)ccc2c1 |
| InChI | InChI=1S/C21H27N3O2/c1-4-6-12-25-18-11-10-15-13-17(9-8-16(15)14-18)20-23-21(26-24-20)19(22-3)7-5-2/h8-11,13-14,19,22H,4-7,12H2,1-3H3/t19-/m0/s1 |
| InChIKey | ZHPOZAUWRGZKIB-IBGZPJMESA-N |
| XLogP | 5.13 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|