C22H31F3N2O2 — CID 145378496
3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(2S)-pentan-2-yl]-1,2,4-oxadiazole (PubChem CID 145378496) has the molecular formula C22H31F3N2O2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(2S)-pentan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(2S)-pentan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145378496 |
| Molecular Formula | C22H31F3N2O2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(2S)-pentan-2-yl]-1,2,4-oxadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2noc([C@@H](C)CCC)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H31F3N2O2/c1-4-6-7-8-9-10-14-28-19-13-12-17(15-18(19)22(23,24)25)20-26-21(29-27-20)16(3)11-5-2/h12-13,15-16H,4-11,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | MSMMOLQFVNYDJQ-INIZCTEOSA-N |
| XLogP | 7.40 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|