C22H30F3N5O3 — CID 145056661
4-hydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 145056661) has the molecular formula C22H30F3N5O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is 4-hydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 4-hydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 145056661 |
| Molecular Formula | C22H30F3N5O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 4-hydroxy-2-[3-[4-octoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(O)CC1c1nc(-c2ccc(OCCCCCCCC)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C22H30F3N5O3/c1-2-3-4-5-6-7-10-32-18-9-8-14(11-16(18)22(23,24)25)19-28-20(33-29-19)17-12-15(31)13-30(17)21(26)27/h8-9,11,15,17,31H,2-7,10,12-13H2,1H3,(H3,26,27) |
| InChIKey | AAFHGLZOLWHJCE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|