C26H30F3N5O — CID 131981269
2-[3-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 131981269) has the molecular formula C26H30F3N5O and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-[3-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 2-[3-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 131981269 |
| Molecular Formula | C26H30F3N5O |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-[3-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1c1nc(-c2ccc(CCc3ccc(CCCC)cc3)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C26H30F3N5O/c1-2-3-5-17-7-9-18(10-8-17)11-12-19-13-14-20(16-21(19)26(27,28)29)23-32-24(35-33-23)22-6-4-15-34(22)25(30)31/h7-10,13-14,16,22H,2-6,11-12,15H2,1H3,(H3,30,31) |
| InChIKey | AZOGGQFRGWGENG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|