C24H32F3N5O — CID 155353241
2-[3-[4-(4-cyclohexylbutyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 155353241) has the molecular formula C24H32F3N5O and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-[3-[4-(4-cyclohexylbutyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 2-[3-[4-(4-cyclohexylbutyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 155353241 |
| Molecular Formula | C24H32F3N5O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-[3-[4-(4-cyclohexylbutyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1c1nc(-c2ccc(CCCCC3CCCCC3)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C24H32F3N5O/c25-24(26,27)19-15-18(13-12-17(19)10-5-4-9-16-7-2-1-3-8-16)21-30-22(33-31-21)20-11-6-14-32(20)23(28)29/h12-13,15-16,20H,1-11,14H2,(H3,28,29) |
| InChIKey | HWNPBFQPZZXPII-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|