C22H22F3N5O3 — CID 155544217
(2S)-2-[3-[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 155544217) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is (2S)-2-[3-[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[3-[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 155544217 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (2S)-2-[3-[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H]1c1nc(-c2ccc(OCc3ccc(C(F)(F)F)cc3)c(OC)c2)no1 |
| InChI | InChI=1S/C22H22F3N5O3/c1-31-18-11-14(19-28-20(33-29-19)16-3-2-10-30(16)21(26)27)6-9-17(18)32-12-13-4-7-15(8-5-13)22(23,24)25/h4-9,11,16H,2-3,10,12H2,1H3,(H3,26,27)/t16-/m0/s1 |
| InChIKey | MGMDEZNFRRQMGG-INIZCTEOSA-N |
| XLogP | 4.37 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|