C26H22F9N5O4 — CID 131965276
2,2,2-trifluoroacetate;[(2S)-2-[3-[3-(trifluoromethyl)-4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine (PubChem CID 131965276) has the molecular formula C26H22F9N5O4 and a molecular weight of 639.48 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;[(2S)-2-[3-[3-(trifluoromethyl)-4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine.
| Compound Name | 2,2,2-trifluoroacetate;[(2S)-2-[3-[3-(trifluoromethyl)-4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 131965276 |
| Molecular Formula | C26H22F9N5O4 |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 2,2,2-trifluoroacetate;[(2S)-2-[3-[3-(trifluoromethyl)-4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
| SMILES | NC(N)=[N+]1CCC[C@H]1c1nc(-c2ccc(OC/C=C/c3cccc(C(F)(F)F)c3)c(C(F)(F)F)c2)no1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H21F6N5O2.C2HF3O2/c25-23(26,27)16-6-1-4-14(12-16)5-3-11-36-19-9-8-15(13-17(19)24(28,29)30)20-33-21(37-34-20)18-7-2-10-35(18)22(31)32;3-2(4,5)1(6)7/h1,3-6,8-9,12-13,18H,2,7,10-11H2,(H3,31,32);(H,6,7)/b5-3+;/t18-;/m0./s1 |
| InChIKey | ULPKBCDAUVKBRJ-DBFXJJBQSA-N |
| XLogP | 4.29 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|