C23H21F4N5O3 — CID 158293271
(2S)-2-[3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-hydroxypyrrolidine-1-carboximidamide (PubChem CID 158293271) has the molecular formula C23H21F4N5O3 and a molecular weight of 491.45 g/mol. Its IUPAC name is (2S)-2-[3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 158293271 |
| Molecular Formula | C23H21F4N5O3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (2S)-2-[3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-hydroxypyrrolidine-1-carboximidamide |
| SMILES | N/C(=N/O)N1CCC[C@H]1c1nc(-c2ccc(OC/C=C/c3ccc(F)cc3)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C23H21F4N5O3/c24-16-8-5-14(6-9-16)3-2-12-34-19-10-7-15(13-17(19)23(25,26)27)20-29-21(35-31-20)18-4-1-11-32(18)22(28)30-33/h2-3,5-10,13,18,33H,1,4,11-12H2,(H2,28,30)/b3-2+/t18-/m0/s1 |
| InChIKey | GLPMGAHKZMLQKP-DCKQQPRJSA-N |
| XLogP | 4.83 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|