C29H34F3N5O4S — CID 177047805
(2S)-2-[3-[4-(2-cyclohexylethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide (PubChem CID 177047805) has the molecular formula C29H34F3N5O4S and a molecular weight of 605.68 g/mol. Its IUPAC name is (2S)-2-[3-[4-(2-cyclohexylethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[3-[4-(2-cyclohexylethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 177047805 |
| Molecular Formula | C29H34F3N5O4S |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | (2S)-2-[3-[4-(2-cyclohexylethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/N)N2CCC[C@H]2c2nc(-c3ccc(OCCC4CCCCC4)c(C(F)(F)F)c3)no2)cc1 |
| InChI | InChI=1S/C29H34F3N5O4S/c1-19-9-12-22(13-10-19)42(38,39)36-28(33)37-16-5-8-24(37)27-34-26(35-41-27)21-11-14-25(23(18-21)29(30,31)32)40-17-15-20-6-3-2-4-7-20/h9-14,18,20,24H,2-8,15-17H2,1H3,(H2,33,36)/t24-/m0/s1 |
| InChIKey | GPBXGTAVOMHVHZ-DEOSSOPVSA-N |
| XLogP | 6.25 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|