C23H26Cl3N5O3 — CID 158000657
(2S,3S)-1-(diaminomethylidene)-2-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-methylphenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride (PubChem CID 158000657) has the molecular formula C23H26Cl3N5O3 and a molecular weight of 526.85 g/mol. Its IUPAC name is (2S,3S)-1-(diaminomethylidene)-2-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-methylphenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride.
| Compound Name | (2S,3S)-1-(diaminomethylidene)-2-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-methylphenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
|---|---|
| PubChem CID | 158000657 |
| Molecular Formula | C23H26Cl3N5O3 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | (2S,3S)-1-(diaminomethylidene)-2-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-methylphenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
| SMILES | Cc1cc(-c2noc([C@@H]3[C@@H](O)CC[N+]3=C(N)N)n2)ccc1OCCCc1ccc(Cl)c(Cl)c1.[Cl-] |
| InChI | InChI=1S/C23H25Cl2N5O3.ClH/c1-13-11-15(21-28-22(33-29-21)20-18(31)8-9-30(20)23(26)27)5-7-19(13)32-10-2-3-14-4-6-16(24)17(25)12-14;/h4-7,11-12,18,20,31H,2-3,8-10H2,1H3,(H3,26,27);1H/t18-,20-;/m0./s1 |
| InChIKey | CZZULLRAWJQRQK-MKSBGGEFSA-N |
| XLogP | 0.46 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|