C23H36N5O+ — CID 154661021
[(3R)-3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine (PubChem CID 154661021) has the molecular formula C23H36N5O+ and a molecular weight of 398.58 g/mol. Its IUPAC name is [(3R)-3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine.
| Compound Name | [(3R)-3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 154661021 |
| Molecular Formula | C23H36N5O+ |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | [(3R)-3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
| SMILES | CCCCCCCCCCc1ccc(-c2noc([C@@H]3CC[N+](=C(N)N)C3)n2)cc1 |
| InChI | InChI=1S/C23H35N5O/c1-2-3-4-5-6-7-8-9-10-18-11-13-19(14-12-18)21-26-22(29-27-21)20-15-16-28(17-20)23(24)25/h11-14,20H,2-10,15-17H2,1H3,(H3,24,25)/p+1/t20-/m1/s1 |
| InChIKey | SDRQQOPGDGVGLO-HXUWFJFHSA-O |
| XLogP | 4.19 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|