C21H32ClN5O2 — CID 118255292
(3R,5S)-1-(diaminomethylidene)-5-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride (PubChem CID 118255292) has the molecular formula C21H32ClN5O2 and a molecular weight of 421.97 g/mol. Its IUPAC name is (3R,5S)-1-(diaminomethylidene)-5-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride.
| Compound Name | (3R,5S)-1-(diaminomethylidene)-5-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
|---|---|
| PubChem CID | 118255292 |
| Molecular Formula | C21H32ClN5O2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (3R,5S)-1-(diaminomethylidene)-5-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
| SMILES | CCCCCCCCc1ccc(-c2noc([C@@H]3C[C@@H](O)C[N+]3=C(N)N)n2)cc1.[Cl-] |
| InChI | InChI=1S/C21H31N5O2.ClH/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)19-24-20(28-25-19)18-13-17(27)14-26(18)21(22)23;/h9-12,17-18,27H,2-8,13-14H2,1H3,(H3,22,23);1H/t17-,18+;/m1./s1 |
| InChIKey | HMEHBENDHAHHNT-URBRKQAFSA-N |
| XLogP | -0.26 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|