C11H12BrNO3 — CID 43516832
2-[4-(bromomethyl)-2,6-dimethoxyphenoxy]acetonitrile (PubChem CID 43516832) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2,6-dimethoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-(bromomethyl)-2,6-dimethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 43516832 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-[4-(bromomethyl)-2,6-dimethoxyphenoxy]acetonitrile |
| SMILES | COc1cc(CBr)cc(OC)c1OCC#N |
| InChI | InChI=1S/C11H12BrNO3/c1-14-9-5-8(7-12)6-10(15-2)11(9)16-4-3-13/h5-6H,4,7H2,1-2H3 |
| InChIKey | MPPIFCHJCWBKOA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|