C16H25BrO4 — CID 61484428
5-(bromomethyl)-1,3-dimethoxy-2-[2-(3-methylbutoxy)ethoxy]benzene (PubChem CID 61484428) has the molecular formula C16H25BrO4 and a molecular weight of 361.28 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dimethoxy-2-[2-(3-methylbutoxy)ethoxy]benzene.
| Compound Name | 5-(bromomethyl)-1,3-dimethoxy-2-[2-(3-methylbutoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 61484428 |
| Molecular Formula | C16H25BrO4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-(bromomethyl)-1,3-dimethoxy-2-[2-(3-methylbutoxy)ethoxy]benzene |
| SMILES | COc1cc(CBr)cc(OC)c1OCCOCCC(C)C |
| InChI | InChI=1S/C16H25BrO4/c1-12(2)5-6-20-7-8-21-16-14(18-3)9-13(11-17)10-15(16)19-4/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | HPFZHZOXINGZHN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|