C22H26Br4O5 — CID 101021543
1-[2-[2-[4,5-bis(bromomethyl)-2-methoxyphenoxy]ethoxy]ethoxy]-4,5-bis(bromomethyl)-2-methoxybenzene (PubChem CID 101021543) has the molecular formula C22H26Br4O5 and a molecular weight of 690.06 g/mol. Its IUPAC name is 1-[2-[2-[4,5-bis(bromomethyl)-2-methoxyphenoxy]ethoxy]ethoxy]-4,5-bis(bromomethyl)-2-methoxybenzene.
| Compound Name | 1-[2-[2-[4,5-bis(bromomethyl)-2-methoxyphenoxy]ethoxy]ethoxy]-4,5-bis(bromomethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 101021543 |
| Molecular Formula | C22H26Br4O5 |
| Molecular Weight | 690.06 g/mol |
| Exact Mass | 685.85 |
| IUPAC Name | 1-[2-[2-[4,5-bis(bromomethyl)-2-methoxyphenoxy]ethoxy]ethoxy]-4,5-bis(bromomethyl)-2-methoxybenzene |
| SMILES | COc1cc(CBr)c(CBr)cc1OCCOCCOc1cc(CBr)c(CBr)cc1OC |
| InChI | InChI=1S/C22H26Br4O5/c1-27-19-7-15(11-23)17(13-25)9-21(19)30-5-3-29-4-6-31-22-10-18(14-26)16(12-24)8-20(22)28-2/h7-10H,3-6,11-14H2,1-2H3 |
| InChIKey | AAHGXVWHZSWIES-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.06 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|