C30H33Br3O6 — CID 52921450
5,12,19-tris(2-bromoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene (PubChem CID 52921450) has the molecular formula C30H33Br3O6 and a molecular weight of 729.30 g/mol. Its IUPAC name is 5,12,19-tris(2-bromoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene.
| Compound Name | 5,12,19-tris(2-bromoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 52921450 |
| Molecular Formula | C30H33Br3O6 |
| Molecular Weight | 729.30 g/mol |
| Exact Mass | 725.98 |
| IUPAC Name | 5,12,19-tris(2-bromoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
| SMILES | COc1cc2c(cc1OCCBr)Cc1cc(OC)c(OCCBr)cc1Cc1cc(OC)c(OCCBr)cc1C2 |
| InChI | InChI=1S/C30H33Br3O6/c1-34-25-13-19-10-23-17-29(38-8-5-32)27(36-3)15-21(23)12-24-18-30(39-9-6-33)26(35-2)14-20(24)11-22(19)16-28(25)37-7-4-31/h13-18H,4-12H2,1-3H3 |
| InChIKey | LOYBHBQQNNVIFH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.30 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|