C30H33N9O6 — CID 53254613
5,12,19-tris(2-azidoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene (PubChem CID 53254613) has the molecular formula C30H33N9O6 and a molecular weight of 615.65 g/mol. Its IUPAC name is 5,12,19-tris(2-azidoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene.
| Compound Name | 5,12,19-tris(2-azidoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 53254613 |
| Molecular Formula | C30H33N9O6 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | 5,12,19-tris(2-azidoethoxy)-6,13,20-trimethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
| SMILES | COc1cc2c(cc1OCCN=[N+]=[N-])Cc1cc(OC)c(OCCN=[N+]=[N-])cc1Cc1cc(OC)c(OCCN=[N+]=[N-])cc1C2 |
| InChI | InChI=1S/C30H33N9O6/c1-40-25-13-19-10-23-17-29(44-8-5-35-38-32)27(42-3)15-21(23)12-24-18-30(45-9-6-36-39-33)26(41-2)14-20(24)11-22(19)16-28(25)43-7-4-34-37-31/h13-18H,4-12H2,1-3H3 |
| InChIKey | XFMYICKOSYJYTC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 201.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|