C16H22ClNO5 — CID 20992240
4-[2-(3-chloro-4,5-diethoxyphenyl)ethylamino]-4-oxobutanoic acid (PubChem CID 20992240) has the molecular formula C16H22ClNO5 and a molecular weight of 343.81 g/mol. Its IUPAC name is 4-[2-(3-chloro-4,5-diethoxyphenyl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(3-chloro-4,5-diethoxyphenyl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20992240 |
| Molecular Formula | C16H22ClNO5 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[2-(3-chloro-4,5-diethoxyphenyl)ethylamino]-4-oxobutanoic acid |
| SMILES | CCOc1cc(CCNC(=O)CCC(=O)O)cc(Cl)c1OCC |
| InChI | InChI=1S/C16H22ClNO5/c1-3-22-13-10-11(9-12(17)16(13)23-4-2)7-8-18-14(19)5-6-15(20)21/h9-10H,3-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | QVTMXRSBABCCSG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |