C20H28ClN3O3 — CID 20990077
N-[2-[3-chloro-5-ethoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide (PubChem CID 20990077) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is N-[2-[3-chloro-5-ethoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide.
| Compound Name | N-[2-[3-chloro-5-ethoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 20990077 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[2-[3-chloro-5-ethoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide |
| SMILES | CCOc1cc(CCNC(=O)CC#N)cc(Cl)c1OCCN1CCCCC1 |
| InChI | InChI=1S/C20H28ClN3O3/c1-2-26-18-15-16(7-9-23-19(25)6-8-22)14-17(21)20(18)27-13-12-24-10-4-3-5-11-24/h14-15H,2-7,9-13H2,1H3,(H,23,25) |
| InChIKey | WSLBVPRMUBOKSH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |