C20H32N2O5 — CID 110642916
3,4,5-triethoxy-N-(2-piperidin-1-ylethoxy)benzamide (PubChem CID 110642916) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(2-piperidin-1-ylethoxy)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 110642916 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3,4,5-triethoxy-N-(2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NOCCN2CCCCC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H32N2O5/c1-4-24-17-14-16(15-18(25-5-2)19(17)26-6-3)20(23)21-27-13-12-22-10-8-7-9-11-22/h14-15H,4-13H2,1-3H3,(H,21,23) |
| InChIKey | VSDLTFWLHZUVPK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|