C22H32N2O6S — CID 41100694
ethyl (3R)-1-[(3,4,5-triethoxybenzoyl)carbamothioyl]piperidine-3-carboxylate (PubChem CID 41100694) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is ethyl (3R)-1-[(3,4,5-triethoxybenzoyl)carbamothioyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3,4,5-triethoxybenzoyl)carbamothioyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 41100694 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | ethyl (3R)-1-[(3,4,5-triethoxybenzoyl)carbamothioyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=S)NC(=O)c2cc(OCC)c(OCC)c(OCC)c2)C1 |
| InChI | InChI=1S/C22H32N2O6S/c1-5-27-17-12-16(13-18(28-6-2)19(17)29-7-3)20(25)23-22(31)24-11-9-10-15(14-24)21(26)30-8-4/h12-13,15H,5-11,14H2,1-4H3,(H,23,25,31)/t15-/m1/s1 |
| InChIKey | QZHWKFABHOVOTK-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|