C24H37N3O7 — CID 24513966
tert-butyl 3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 24513966) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is tert-butyl 3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24513966 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | tert-butyl 3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOc1cc(C(=O)NNC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H37N3O7/c1-7-31-18-13-17(14-19(32-8-2)20(18)33-9-3)22(29)26-25-21(28)16-11-10-12-27(15-16)23(30)34-24(4,5)6/h13-14,16H,7-12,15H2,1-6H3,(H,25,28)(H,26,29) |
| InChIKey | LWWMOJUGGBGPMG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|