C21H27N3O5 — CID 24515671
tert-butyl 3-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 24515671) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl 3-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24515671 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl 3-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1c(C(=O)NNC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)oc2ccccc12 |
| InChI | InChI=1S/C21H27N3O5/c1-13-15-9-5-6-10-16(15)28-17(13)19(26)23-22-18(25)14-8-7-11-24(12-14)20(27)29-21(2,3)4/h5-6,9-10,14H,7-8,11-12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | MAUWBLARGYSMBO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|