C19H26ClN3O3 — CID 22683562
N-[2-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide (PubChem CID 22683562) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[2-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide.
| Compound Name | N-[2-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 22683562 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]ethyl]-2-cyanoacetamide |
| SMILES | COc1cc(CCNC(=O)CC#N)cc(Cl)c1OCCN1CCCCC1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-25-17-14-15(6-8-22-18(24)5-7-21)13-16(20)19(17)26-12-11-23-9-3-2-4-10-23/h13-14H,2-6,8-12H2,1H3,(H,22,24) |
| InChIKey | MUPNTZPQEDFJHD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |