C15H10Cl2INO2 — CID 91683464
4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxybenzonitrile (PubChem CID 91683464) has the molecular formula C15H10Cl2INO2 and a molecular weight of 434.06 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxybenzonitrile.
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 91683464 |
| Molecular Formula | C15H10Cl2INO2 |
| Molecular Weight | 434.06 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2INO2/c1-20-14-6-10(7-19)5-13(18)15(14)21-8-9-2-3-11(16)12(17)4-9/h2-6H,8H2,1H3 |
| InChIKey | RQIRRPAWPZJRJV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.06 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|