C10H9IN2O3 — CID 19617721
2-(4-cyano-2-iodo-6-methoxyphenoxy)acetamide (PubChem CID 19617721) has the molecular formula C10H9IN2O3 and a molecular weight of 332.10 g/mol. Its IUPAC name is 2-(4-cyano-2-iodo-6-methoxyphenoxy)acetamide.
| Compound Name | 2-(4-cyano-2-iodo-6-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 19617721 |
| Molecular Formula | C10H9IN2O3 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 2-(4-cyano-2-iodo-6-methoxyphenoxy)acetamide |
| SMILES | COc1cc(C#N)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C10H9IN2O3/c1-15-8-3-6(4-12)2-7(11)10(8)16-5-9(13)14/h2-3H,5H2,1H3,(H2,13,14) |
| InChIKey | NYONQZSRBMDEHH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|