C15H11Cl2NO2 — CID 22683873
2-[(3,4-dichlorophenyl)methoxy]-4-methoxybenzonitrile (PubChem CID 22683873) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methoxy]-4-methoxybenzonitrile.
| Compound Name | 2-[(3,4-dichlorophenyl)methoxy]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 22683873 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methoxy]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H11Cl2NO2/c1-19-12-4-3-11(8-18)15(7-12)20-9-10-2-5-13(16)14(17)6-10/h2-7H,9H2,1H3 |
| InChIKey | FZQJUQRZQXABDU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |