C15H10Cl3NO2 — CID 106788537
2-methoxy-4-[(2,4,5-trichlorophenoxy)methyl]benzonitrile (PubChem CID 106788537) has the molecular formula C15H10Cl3NO2 and a molecular weight of 342.61 g/mol. Its IUPAC name is 2-methoxy-4-[(2,4,5-trichlorophenoxy)methyl]benzonitrile.
| Compound Name | 2-methoxy-4-[(2,4,5-trichlorophenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 106788537 |
| Molecular Formula | C15H10Cl3NO2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-methoxy-4-[(2,4,5-trichlorophenoxy)methyl]benzonitrile |
| SMILES | COc1cc(COc2cc(Cl)c(Cl)cc2Cl)ccc1C#N |
| InChI | InChI=1S/C15H10Cl3NO2/c1-20-14-4-9(2-3-10(14)7-19)8-21-15-6-12(17)11(16)5-13(15)18/h2-6H,8H2,1H3 |
| InChIKey | XGCWYDRPHFEGPC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|