About [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate
[(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate (PubChem CID 9499045) has the molecular formula C31H29O10P
and a molecular weight of 592.54 g/mol. Its IUPAC name is [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate |
| PubChem CID | 9499045 |
| Molecular Formula | C31H29O10P |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC[C@@H](COP(=O)(Oc2ccccc2)Oc2ccccc2)OC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H29O10P/c1-35-25-17-13-23(14-18-25)30(32)37-21-29(39-31(33)24-15-19-26(36-2)20-16-24)22-38-42(34,40-27-9-5-3-6-10-27)41-28-11-7-4-8-12-28/h3-20,29H,21-22H2,1-2H3/t29-/m0/s1 |
| InChIKey | ZJSIURNOZQLJMI-LJAQVGFWSA-N |
| XLogP | 6.37 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate?
The IUPAC name of [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate (CID 9499045) is [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate.
What is the SMILES notation for [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate?
The canonical SMILES for [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate is COc1ccc(C(=O)OC[C@@H](COP(=O)(Oc2ccccc2)Oc2ccccc2)OC(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate?
The InChIKey is ZJSIURNOZQLJMI-LJAQVGFWSA-N. The full InChI is InChI=1S/C31H29O10P/c1-35-25-17-13-23(14-18-25)30(32)37-21-29(39-31(33)24-15-19-26(36-2)20-16-24)22-38-42(34,40-27-9-5-3-6-10-27)41-28-11-7-4-8-12-28/h3-20,29H,21-22H2,1-2H3/t29-/m0/s1.
What are the key properties of [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate?
[(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate has a molecular weight of 592.54 g/mol, XLogP of 6.37, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-diphenoxyphosphoryloxy-2-(4-methoxybenzoyl)oxypropyl] 4-methoxybenzoate is sourced from PubChem (CID 9499045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).