C31H45O8P — CID 165342805
[(2R)-3-diphenoxyphosphoryloxy-2-octanoyloxypropyl] octanoate (PubChem CID 165342805) has the molecular formula C31H45O8P and a molecular weight of 576.67 g/mol. Its IUPAC name is [(2R)-3-diphenoxyphosphoryloxy-2-octanoyloxypropyl] octanoate.
| Compound Name | [(2R)-3-diphenoxyphosphoryloxy-2-octanoyloxypropyl] octanoate |
|---|---|
| PubChem CID | 165342805 |
| Molecular Formula | C31H45O8P |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [(2R)-3-diphenoxyphosphoryloxy-2-octanoyloxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(Oc1ccccc1)Oc1ccccc1)OC(=O)CCCCCCC |
| InChI | InChI=1S/C31H45O8P/c1-3-5-7-9-17-23-30(32)35-25-29(37-31(33)24-18-10-8-6-4-2)26-36-40(34,38-27-19-13-11-14-20-27)39-28-21-15-12-16-22-28/h11-16,19-22,29H,3-10,17-18,23-26H2,1-2H3/t29-/m1/s1 |
| InChIKey | JDXYOOYYJCRZNY-GDLZYMKVSA-N |
| XLogP | 8.45 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|