C27H22O7 — CID 177453026
[(E,2R)-2,6-dibenzoyloxy-5-oxohex-3-enyl] benzoate (PubChem CID 177453026) has the molecular formula C27H22O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is [(E,2R)-2,6-dibenzoyloxy-5-oxohex-3-enyl] benzoate.
| Compound Name | [(E,2R)-2,6-dibenzoyloxy-5-oxohex-3-enyl] benzoate |
|---|---|
| PubChem CID | 177453026 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(E,2R)-2,6-dibenzoyloxy-5-oxohex-3-enyl] benzoate |
| SMILES | O=C(/C=C/[C@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22O7/c28-23(18-32-25(29)20-10-4-1-5-11-20)16-17-24(34-27(31)22-14-8-3-9-15-22)19-33-26(30)21-12-6-2-7-13-21/h1-17,24H,18-19H2/b17-16+/t24-/m1/s1 |
| InChIKey | PUERQGRNBFGIHY-GQRCBVMOSA-N |
| XLogP | 4.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|