C22H25N3O6 — CID 172882942
[(2R,3R,4R,5R)-5-azido-2-hydroxy-6-oxo-3,4-bis(phenylmethoxy)hexyl] acetate (PubChem CID 172882942) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-azido-2-hydroxy-6-oxo-3,4-bis(phenylmethoxy)hexyl] acetate.
| Compound Name | [(2R,3R,4R,5R)-5-azido-2-hydroxy-6-oxo-3,4-bis(phenylmethoxy)hexyl] acetate |
|---|---|
| PubChem CID | 172882942 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5-azido-2-hydroxy-6-oxo-3,4-bis(phenylmethoxy)hexyl] acetate |
| SMILES | CC(=O)OC[C@@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C=O)N=[N+]=[N-] |
| InChI | InChI=1S/C22H25N3O6/c1-16(27)29-15-20(28)22(31-14-18-10-6-3-7-11-18)21(19(12-26)24-25-23)30-13-17-8-4-2-5-9-17/h2-12,19-22,28H,13-15H2,1H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | XDLKJAHSHRLZAC-DXBBTUNJSA-N |
| XLogP | 2.96 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|