C8H19NO14P2 — CID 158104006
(2R,3S,4R,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide;phosphono dihydrogen phosphate (PubChem CID 158104006) has the molecular formula C8H19NO14P2 and a molecular weight of 415.18 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide;phosphono dihydrogen phosphate.
| Compound Name | (2R,3S,4R,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 158104006 |
| Molecular Formula | C8H19NO14P2 |
| Molecular Weight | 415.18 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | (2R,3S,4R,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide;phosphono dihydrogen phosphate |
| SMILES | CC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C8H15NO7.H4O7P2/c1-3(11)9-8(16)7(15)6(14)5(13)4(12)2-10;1-8(2,3)7-9(4,5)6/h4-7,10,12-15H,2H2,1H3,(H,9,11,16);(H2,1,2,3)(H2,4,5,6)/t4-,5-,6+,7-;/m1./s1 |
| InChIKey | FPPNMVIVYRZCHV-FCWDRERSSA-N |
| XLogP | -4.73 |
| TPSA | 271.61 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.18 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|