C6H15NO11P2 — CID 87558180
[(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoyl]-phosphonooxyphosphinic acid (PubChem CID 87558180) has the molecular formula C6H15NO11P2 and a molecular weight of 339.13 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoyl]-phosphonooxyphosphinic acid.
| Compound Name | [(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoyl]-phosphonooxyphosphinic acid |
|---|---|
| PubChem CID | 87558180 |
| Molecular Formula | C6H15NO11P2 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | [(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoyl]-phosphonooxyphosphinic acid |
| SMILES | N[C@@H](C(=O)P(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO11P2/c7-3(5(11)4(10)2(9)1-8)6(12)19(13,14)18-20(15,16)17/h2-5,8-11H,1,7H2,(H,13,14)(H2,15,16,17)/t2-,3-,4-,5-/m1/s1 |
| InChIKey | PNZGIZQMFGVEGV-TXICZTDVSA-N |
| XLogP | -3.79 |
| TPSA | 228.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|