C6H19O22P5 — CID 175070891
bis[hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175070891) has the molecular formula C6H19O22P5 and a molecular weight of 598.07 g/mol. Its IUPAC name is bis[hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | bis[hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175070891 |
| Molecular Formula | C6H19O22P5 |
| Molecular Weight | 598.07 g/mol |
| Exact Mass | 597.91 |
| IUPAC Name | bis[hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.O=P(O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H12O6.H7O16P5/c7-1-3(9)5(11)6(12)4(10)2-8;1-17(2,3)13-19(7,8)15-21(11,12)16-20(9,10)14-18(4,5)6/h1,3-6,8-12H,2H2;(H,7,8)(H,9,10)(H,11,12)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | SHBITRQFOGVIMY-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 382.10 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.07 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|