C5H7O14P3-6 — CID 21145033
[(2R,3R,4R)-1-hydroxy-5-oxo-2,4-diphosphonatooxypentan-3-yl] phosphate (PubChem CID 21145033) has the molecular formula C5H7O14P3-6 and a molecular weight of 384.02 g/mol. Its IUPAC name is [(2R,3R,4R)-1-hydroxy-5-oxo-2,4-diphosphonatooxypentan-3-yl] phosphate.
| Compound Name | [(2R,3R,4R)-1-hydroxy-5-oxo-2,4-diphosphonatooxypentan-3-yl] phosphate |
|---|---|
| PubChem CID | 21145033 |
| Molecular Formula | C5H7O14P3-6 |
| Molecular Weight | 384.02 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | [(2R,3R,4R)-1-hydroxy-5-oxo-2,4-diphosphonatooxypentan-3-yl] phosphate |
| SMILES | O=C[C@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@@H](CO)OP(=O)([O-])[O-] |
| InChI | InChI=1S/C5H13O14P3/c6-1-3(17-20(8,9)10)5(19-22(14,15)16)4(2-7)18-21(11,12)13/h1,3-5,7H,2H2,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)/p-6/t3-,4+,5-/m0/s1 |
| InChIKey | KVYRLKJYZGMKMP-LMVFSUKVSA-H |
| XLogP | -6.18 |
| TPSA | 254.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.02 |
| LogP ≤ 5 | -6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|