C3H5BaO7P — CID 133108684
barium(2+);3-hydroxy-2-[hydroxy(oxido)phosphoryl]oxypropanoate (PubChem CID 133108684) has the molecular formula C3H5BaO7P and a molecular weight of 321.37 g/mol. Its IUPAC name is barium(2+);3-hydroxy-2-[hydroxy(oxido)phosphoryl]oxypropanoate.
| Compound Name | barium(2+);3-hydroxy-2-[hydroxy(oxido)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 133108684 |
| Molecular Formula | C3H5BaO7P |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | barium(2+);3-hydroxy-2-[hydroxy(oxido)phosphoryl]oxypropanoate |
| SMILES | O=C([O-])C(CO)OP(=O)([O-])O.[Ba+2] |
| InChI | InChI=1S/C3H7O7P.Ba/c4-1-2(3(5)6)10-11(7,8)9;/h2,4H,1H2,(H,5,6)(H2,7,8,9);/q;+2/p-2 |
| InChIKey | VDCXVAFBCOMLAH-UHFFFAOYSA-L |
| XLogP | -3.81 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|