C6H12O13P2 — CID 54283572
2-[(1-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-3-hydroxypropanoic acid (PubChem CID 54283572) has the molecular formula C6H12O13P2 and a molecular weight of 354.10 g/mol. Its IUPAC name is 2-[(1-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-3-hydroxypropanoic acid.
| Compound Name | 2-[(1-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 54283572 |
| Molecular Formula | C6H12O13P2 |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-[(1-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(CO)OP(=O)(O)OC(COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H12O13P2/c7-1-3(5(8)9)18-21(15,16)19-4(6(10)11)2-17-20(12,13)14/h3-4,7H,1-2H2,(H,8,9)(H,10,11)(H,15,16)(H2,12,13,14) |
| InChIKey | RSMWSXNLNCQCGZ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 217.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|