C6H13O16P3 — CID 87534689
3-[(2-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-2-phosphonooxypropanoic acid (PubChem CID 87534689) has the molecular formula C6H13O16P3 and a molecular weight of 434.08 g/mol. Its IUPAC name is 3-[(2-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-2-phosphonooxypropanoic acid.
| Compound Name | 3-[(2-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-2-phosphonooxypropanoic acid |
|---|---|
| PubChem CID | 87534689 |
| Molecular Formula | C6H13O16P3 |
| Molecular Weight | 434.08 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | 3-[(2-carboxy-2-phosphonooxyethoxy)-hydroxyphosphoryl]oxy-2-phosphonooxypropanoic acid |
| SMILES | O=C(O)C(COP(=O)(O)OCC(OP(=O)(O)O)C(=O)O)OP(=O)(O)O |
| InChI | InChI=1S/C6H13O16P3/c7-5(8)3(21-23(11,12)13)1-19-25(17,18)20-2-4(6(9)10)22-24(14,15)16/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,17,18)(H2,11,12,13)(H2,14,15,16) |
| InChIKey | AJUNAOBEFODTGU-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 263.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.08 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|