C6H13NO8P- — CID 57339260
(2S)-2-azaniumyl-3-[[(2R)-2,3-dihydroxypropoxy]-oxidophosphoryl]oxypropanoate (PubChem CID 57339260) has the molecular formula C6H13NO8P- and a molecular weight of 258.14 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-[[(2R)-2,3-dihydroxypropoxy]-oxidophosphoryl]oxypropanoate.
| Compound Name | (2S)-2-azaniumyl-3-[[(2R)-2,3-dihydroxypropoxy]-oxidophosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 57339260 |
| Molecular Formula | C6H13NO8P- |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2S)-2-azaniumyl-3-[[(2R)-2,3-dihydroxypropoxy]-oxidophosphoryl]oxypropanoate |
| SMILES | [NH3+][C@@H](COP(=O)([O-])OC[C@H](O)CO)C(=O)[O-] |
| InChI | InChI=1S/C6H14NO8P/c7-5(6(10)11)3-15-16(12,13)14-2-4(9)1-8/h4-5,8-9H,1-3,7H2,(H,10,11)(H,12,13)/p-1/t4-,5+/m1/s1 |
| InChIKey | ZWZWYGMENQVNFU-UHNVWZDZSA-M |
| XLogP | -4.80 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|