C9H22NO6P — CID 172836659
[(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)propan-2-yl phosphate (PubChem CID 172836659) has the molecular formula C9H22NO6P and a molecular weight of 271.25 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)propan-2-yl phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)propan-2-yl phosphate |
|---|---|
| PubChem CID | 172836659 |
| Molecular Formula | C9H22NO6P |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] 1-(trimethylazaniumyl)propan-2-yl phosphate |
| SMILES | CC(C[N+](C)(C)C)OP(=O)([O-])OC[C@H](O)CO |
| InChI | InChI=1S/C9H22NO6P/c1-8(5-10(2,3)4)16-17(13,14)15-7-9(12)6-11/h8-9,11-12H,5-7H2,1-4H3/t8?,9-/m1/s1 |
| InChIKey | WFVSBDGYBPIUTK-YGPZHTELSA-N |
| XLogP | -1.06 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|