C10H23NO8P+ — CID 87778117
[3-carboxy-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 87778117) has the molecular formula C10H23NO8P+ and a molecular weight of 316.27 g/mol. Its IUPAC name is [3-carboxy-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 87778117 |
| Molecular Formula | C10H23NO8P+ |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [3-carboxy-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C10H22NO8P/c1-11(2,3)5-9(4-10(14)15)19-20(16,17)18-7-8(13)6-12/h8-9,12-13H,4-7H2,1-3H3,(H-,14,15,16,17)/p+1 |
| InChIKey | UKMKKYLKZLCZRB-UHFFFAOYSA-O |
| XLogP | -0.98 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|