C6H14NO8P — CID 163859987
2,3-dihydroxypropyl (1-hydroxy-3-nitrosopropan-2-yl) hydrogen phosphate (PubChem CID 163859987) has the molecular formula C6H14NO8P and a molecular weight of 259.15 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (1-hydroxy-3-nitrosopropan-2-yl) hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl (1-hydroxy-3-nitrosopropan-2-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 163859987 |
| Molecular Formula | C6H14NO8P |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2,3-dihydroxypropyl (1-hydroxy-3-nitrosopropan-2-yl) hydrogen phosphate |
| SMILES | O=NCC(CO)OP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C6H14NO8P/c8-2-5(10)4-14-16(12,13)15-6(3-9)1-7-11/h5-6,8-10H,1-4H2,(H,12,13) |
| InChIKey | IIWQKVMHMAMHMU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|